C24H44Cl6 — CID 6537497
4,8,11,14,17,21-hexachlorotetracosane (PubChem CID 6537497) has the molecular formula C24H44Cl6 and a molecular weight of 545.33 g/mol. Its IUPAC name is 4,8,11,14,17,21-hexachlorotetracosane.
| Compound Name | 4,8,11,14,17,21-hexachlorotetracosane |
|---|---|
| PubChem CID | 6537497 |
| Molecular Formula | C24H44Cl6 |
| Molecular Weight | 545.33 g/mol |
| Exact Mass | 542.16 |
| IUPAC Name | 4,8,11,14,17,21-hexachlorotetracosane |
| SMILES | CCCC(Cl)CCCC(Cl)CCC(Cl)CCC(Cl)CCC(Cl)CCCC(Cl)CCC |
| InChI | InChI=1S/C24H44Cl6/c1-3-7-19(25)9-5-11-21(27)13-15-23(29)17-18-24(30)16-14-22(28)12-6-10-20(26)8-4-2/h19-24H,3-18H2,1-2H3 |
| InChIKey | QKUNKVYPGIOQNP-UHFFFAOYSA-N |
| XLogP | 10.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.33 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|