C24H43Cl7 — CID 22833490
1,3,7,11,15,19,23-heptachlorotetracosane (PubChem CID 22833490) has the molecular formula C24H43Cl7 and a molecular weight of 579.78 g/mol. Its IUPAC name is 1,3,7,11,15,19,23-heptachlorotetracosane.
| Compound Name | 1,3,7,11,15,19,23-heptachlorotetracosane |
|---|---|
| PubChem CID | 22833490 |
| Molecular Formula | C24H43Cl7 |
| Molecular Weight | 579.78 g/mol |
| Exact Mass | 576.12 |
| IUPAC Name | 1,3,7,11,15,19,23-heptachlorotetracosane |
| SMILES | CC(Cl)CCCC(Cl)CCCC(Cl)CCCC(Cl)CCCC(Cl)CCCC(Cl)CCCl |
| InChI | InChI=1S/C24H43Cl7/c1-19(26)7-2-8-20(27)9-3-10-21(28)11-4-12-22(29)13-5-14-23(30)15-6-16-24(31)17-18-25/h19-24H,2-18H2,1H3 |
| InChIKey | FHKUUILMHIOLID-UHFFFAOYSA-N |
| XLogP | 11.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 22 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.78 |
| LogP ≤ 5 | 11.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|