C12H22Cl4O — CID 56996879
1,3-dichloro-1-(1,3-dichlorohexoxy)hexane (PubChem CID 56996879) has the molecular formula C12H22Cl4O and a molecular weight of 324.12 g/mol. Its IUPAC name is 1,3-dichloro-1-(1,3-dichlorohexoxy)hexane.
| Compound Name | 1,3-dichloro-1-(1,3-dichlorohexoxy)hexane |
|---|---|
| PubChem CID | 56996879 |
| Molecular Formula | C12H22Cl4O |
| Molecular Weight | 324.12 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 1,3-dichloro-1-(1,3-dichlorohexoxy)hexane |
| SMILES | CCCC(Cl)CC(Cl)OC(Cl)CC(Cl)CCC |
| InChI | InChI=1S/C12H22Cl4O/c1-3-5-9(13)7-11(15)17-12(16)8-10(14)6-4-2/h9-12H,3-8H2,1-2H3 |
| InChIKey | HYNIRZGBIYPMMO-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.12 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|