About azane;2-chloropentadecane
azane;2-chloropentadecane (PubChem CID 88746937) has the molecular formula C15H34ClN
and a molecular weight of 263.90 g/mol. Its IUPAC name is azane;2-chloropentadecane.
Molecular Properties
| Compound Name | azane;2-chloropentadecane |
| PubChem CID | 88746937 |
| Molecular Formula | C15H34ClN |
| Molecular Weight | 263.90 g/mol |
| Exact Mass | 263.24 |
| IUPAC Name | azane;2-chloropentadecane |
| SMILES | CCCCCCCCCCCCCC(C)Cl.N |
| InChI | InChI=1S/C15H31Cl.H3N/c1-3-4-5-6-7-8-9-10-11-12-13-14-15(2)16;/h15H,3-14H2,1-2H3;1H3 |
| InChIKey | IQJVPWUNXBYFQX-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 263.90 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze azane;2-chloropentadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-chloropentadecane?
The IUPAC name of azane;2-chloropentadecane (CID 88746937) is azane;2-chloropentadecane.
What is the SMILES notation for azane;2-chloropentadecane?
The canonical SMILES for azane;2-chloropentadecane is CCCCCCCCCCCCCC(C)Cl.N.
What is the InChIKey of azane;2-chloropentadecane?
The InChIKey is IQJVPWUNXBYFQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31Cl.H3N/c1-3-4-5-6-7-8-9-10-11-12-13-14-15(2)16;/h15H,3-14H2,1-2H3;1H3.
What are the key properties of azane;2-chloropentadecane?
azane;2-chloropentadecane has a molecular weight of 263.90 g/mol, XLogP of 6.48, 12 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-chloropentadecane is sourced from PubChem (CID 88746937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).