About 2-chlorododecan-5-ol
2-chlorododecan-5-ol (PubChem CID 173403763) has the molecular formula C12H25ClO
and a molecular weight of 220.78 g/mol. Its IUPAC name is 2-chlorododecan-5-ol.
Molecular Properties
| Compound Name | 2-chlorododecan-5-ol |
| PubChem CID | 173403763 |
| Molecular Formula | C12H25ClO |
| Molecular Weight | 220.78 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 2-chlorododecan-5-ol |
| SMILES | CCCCCCCC(O)CCC(C)Cl |
| InChI | InChI=1S/C12H25ClO/c1-3-4-5-6-7-8-12(14)10-9-11(2)13/h11-12,14H,3-10H2,1-2H3 |
| InChIKey | HRBKMGHAQZGLSR-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.78 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chlorododecan-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chlorododecan-5-ol?
The IUPAC name of 2-chlorododecan-5-ol (CID 173403763) is 2-chlorododecan-5-ol.
What is the SMILES notation for 2-chlorododecan-5-ol?
The canonical SMILES for 2-chlorododecan-5-ol is CCCCCCCC(O)CCC(C)Cl.
What is the InChIKey of 2-chlorododecan-5-ol?
The InChIKey is HRBKMGHAQZGLSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25ClO/c1-3-4-5-6-7-8-12(14)10-9-11(2)13/h11-12,14H,3-10H2,1-2H3.
What are the key properties of 2-chlorododecan-5-ol?
2-chlorododecan-5-ol has a molecular weight of 220.78 g/mol, XLogP of 4.12, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chlorododecan-5-ol is sourced from PubChem (CID 173403763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).