C9H16Cl4 — CID 98103574
(2R,8S)-1,2,8,9-tetrachlorononane (PubChem CID 98103574) has the molecular formula C9H16Cl4 and a molecular weight of 266.04 g/mol. Its IUPAC name is (2R,8S)-1,2,8,9-tetrachlorononane.
| Compound Name | (2R,8S)-1,2,8,9-tetrachlorononane |
|---|---|
| PubChem CID | 98103574 |
| Molecular Formula | C9H16Cl4 |
| Molecular Weight | 266.04 g/mol |
| Exact Mass | 264.00 |
| IUPAC Name | (2R,8S)-1,2,8,9-tetrachlorononane |
| SMILES | ClC[C@@H](Cl)CCCCC[C@@H](Cl)CCl |
| InChI | InChI=1S/C9H16Cl4/c10-6-8(12)4-2-1-3-5-9(13)7-11/h8-9H,1-7H2/t8-,9+ |
| InChIKey | XYOZQZZVJXSSML-DTORHVGOSA-N |
| XLogP | 4.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.04 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|