C6H17ClN2 — CID 87947838
1-chloropropan-1-amine;N,N-dimethylmethanamine (PubChem CID 87947838) has the molecular formula C6H17ClN2 and a molecular weight of 152.67 g/mol. Its IUPAC name is 1-chloropropan-1-amine;N,N-dimethylmethanamine.
| Compound Name | 1-chloropropan-1-amine;N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 87947838 |
| Molecular Formula | C6H17ClN2 |
| Molecular Weight | 152.67 g/mol |
| Exact Mass | 152.11 |
| IUPAC Name | 1-chloropropan-1-amine;N,N-dimethylmethanamine |
| SMILES | CCC(N)Cl.CN(C)C |
| InChI | InChI=1S/C3H8ClN.C3H9N/c1-2-3(4)5;1-4(2)3/h3H,2,5H2,1H3;1-3H3 |
| InChIKey | YFIFDKIRZIIKCT-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.67 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|