C5H13ClN2 — CID 56979251
1-chloro-N,N-dimethylpropane-1,3-diamine (PubChem CID 56979251) has the molecular formula C5H13ClN2 and a molecular weight of 136.63 g/mol. Its IUPAC name is 1-chloro-N,N-dimethylpropane-1,3-diamine.
| Compound Name | 1-chloro-N,N-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 56979251 |
| Molecular Formula | C5H13ClN2 |
| Molecular Weight | 136.63 g/mol |
| Exact Mass | 136.08 |
| IUPAC Name | 1-chloro-N,N-dimethylpropane-1,3-diamine |
| SMILES | CN(C)C(Cl)CCN |
| InChI | InChI=1S/C5H13ClN2/c1-8(2)5(6)3-4-7/h5H,3-4,7H2,1-2H3 |
| InChIKey | HAUUXUBJACGMIH-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.63 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|