C5H16Cl2N2 — CID 87420942
2-chloroethanamine;N,N-dimethylmethanamine;hydrochloride (PubChem CID 87420942) has the molecular formula C5H16Cl2N2 and a molecular weight of 175.10 g/mol. Its IUPAC name is 2-chloroethanamine;N,N-dimethylmethanamine;hydrochloride.
| Compound Name | 2-chloroethanamine;N,N-dimethylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 87420942 |
| Molecular Formula | C5H16Cl2N2 |
| Molecular Weight | 175.10 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | 2-chloroethanamine;N,N-dimethylmethanamine;hydrochloride |
| SMILES | CN(C)C.Cl.NCCCl |
| InChI | InChI=1S/C3H9N.C2H6ClN.ClH/c1-4(2)3;3-1-2-4;/h1-3H3;1-2,4H2;1H |
| InChIKey | TYQSVVUEFATTKW-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.10 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|