C5H14N2 — CID 92569177
(1R)-1-N',1-N'-dimethylpropane-1,1-diamine (PubChem CID 92569177) has the molecular formula C5H14N2 and a molecular weight of 102.18 g/mol. Its IUPAC name is (1R)-1-N',1-N'-dimethylpropane-1,1-diamine.
| Compound Name | (1R)-1-N',1-N'-dimethylpropane-1,1-diamine |
|---|---|
| PubChem CID | 92569177 |
| Molecular Formula | C5H14N2 |
| Molecular Weight | 102.18 g/mol |
| Exact Mass | 102.12 |
| IUPAC Name | (1R)-1-N',1-N'-dimethylpropane-1,1-diamine |
| SMILES | CC[C@H](N)N(C)C |
| InChI | InChI=1S/C5H14N2/c1-4-5(6)7(2)3/h5H,4,6H2,1-3H3/t5-/m1/s1 |
| InChIKey | OOFAEFCMEHZNGP-RXMQYKEDSA-N |
| XLogP | 0.24 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 102.18 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|