C7H19N3 — CID 22987584
1-N'-(3-aminopropyl)-1-N'-methylpropane-1,1-diamine (PubChem CID 22987584) has the molecular formula C7H19N3 and a molecular weight of 145.25 g/mol. Its IUPAC name is 1-N'-(3-aminopropyl)-1-N'-methylpropane-1,1-diamine.
| Compound Name | 1-N'-(3-aminopropyl)-1-N'-methylpropane-1,1-diamine |
|---|---|
| PubChem CID | 22987584 |
| Molecular Formula | C7H19N3 |
| Molecular Weight | 145.25 g/mol |
| Exact Mass | 145.16 |
| IUPAC Name | 1-N'-(3-aminopropyl)-1-N'-methylpropane-1,1-diamine |
| SMILES | CCC(N)N(C)CCCN |
| InChI | InChI=1S/C7H19N3/c1-3-7(9)10(2)6-4-5-8/h7H,3-6,8-9H2,1-2H3 |
| InChIKey | QZMOONXVPGJPGE-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.25 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|