C10H26N4 — CID 87385985
1-N',1-N'-bis(3-aminopropyl)butane-1,1-diamine (PubChem CID 87385985) has the molecular formula C10H26N4 and a molecular weight of 202.35 g/mol. Its IUPAC name is 1-N',1-N'-bis(3-aminopropyl)butane-1,1-diamine.
| Compound Name | 1-N',1-N'-bis(3-aminopropyl)butane-1,1-diamine |
|---|---|
| PubChem CID | 87385985 |
| Molecular Formula | C10H26N4 |
| Molecular Weight | 202.35 g/mol |
| Exact Mass | 202.22 |
| IUPAC Name | 1-N',1-N'-bis(3-aminopropyl)butane-1,1-diamine |
| SMILES | CCCC(N)N(CCCN)CCCN |
| InChI | InChI=1S/C10H26N4/c1-2-5-10(13)14(8-3-6-11)9-4-7-12/h10H,2-9,11-13H2,1H3 |
| InChIKey | XQZVPQYPWLTDDG-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.35 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|