C11H26N4O — CID 175579249
(2S)-2,6-diamino-N-(1-aminobutyl)-N-methylhexanamide (PubChem CID 175579249) has the molecular formula C11H26N4O and a molecular weight of 230.36 g/mol. Its IUPAC name is (2S)-2,6-diamino-N-(1-aminobutyl)-N-methylhexanamide.
| Compound Name | (2S)-2,6-diamino-N-(1-aminobutyl)-N-methylhexanamide |
|---|---|
| PubChem CID | 175579249 |
| Molecular Formula | C11H26N4O |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.21 |
| IUPAC Name | (2S)-2,6-diamino-N-(1-aminobutyl)-N-methylhexanamide |
| SMILES | CCCC(N)N(C)C(=O)[C@@H](N)CCCCN |
| InChI | InChI=1S/C11H26N4O/c1-3-6-10(14)15(2)11(16)9(13)7-4-5-8-12/h9-10H,3-8,12-14H2,1-2H3/t9-,10?/m0/s1 |
| InChIKey | AWSSIPCKYBYZMW-RGURZIINSA-N |
| XLogP | -0.01 |
| TPSA | 98.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|