C11H26N6O — CID 175579254
(2S)-2-amino-N-(1-aminobutyl)-5-(diaminomethylideneamino)-N-methylpentanamide (PubChem CID 175579254) has the molecular formula C11H26N6O and a molecular weight of 258.37 g/mol. Its IUPAC name is (2S)-2-amino-N-(1-aminobutyl)-5-(diaminomethylideneamino)-N-methylpentanamide.
| Compound Name | (2S)-2-amino-N-(1-aminobutyl)-5-(diaminomethylideneamino)-N-methylpentanamide |
|---|---|
| PubChem CID | 175579254 |
| Molecular Formula | C11H26N6O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.22 |
| IUPAC Name | (2S)-2-amino-N-(1-aminobutyl)-5-(diaminomethylideneamino)-N-methylpentanamide |
| SMILES | CCCC(N)N(C)C(=O)[C@@H](N)CCCN=C(N)N |
| InChI | InChI=1S/C11H26N6O/c1-3-5-9(13)17(2)10(18)8(12)6-4-7-16-11(14)15/h8-9H,3-7,12-13H2,1-2H3,(H4,14,15,16)/t8-,9?/m0/s1 |
| InChIKey | QJGNRXORIYRQIC-IENPIDJESA-N |
| XLogP | -1.09 |
| TPSA | 136.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|