C22H43N3O3 — CID 139816414
N-[(2S)-2,6-diaminohexanoyl]-N-octanoyloctanamide (PubChem CID 139816414) has the molecular formula C22H43N3O3 and a molecular weight of 397.60 g/mol. Its IUPAC name is N-[(2S)-2,6-diaminohexanoyl]-N-octanoyloctanamide.
| Compound Name | N-[(2S)-2,6-diaminohexanoyl]-N-octanoyloctanamide |
|---|---|
| PubChem CID | 139816414 |
| Molecular Formula | C22H43N3O3 |
| Molecular Weight | 397.60 g/mol |
| Exact Mass | 397.33 |
| IUPAC Name | N-[(2S)-2,6-diaminohexanoyl]-N-octanoyloctanamide |
| SMILES | CCCCCCCC(=O)N(C(=O)CCCCCCC)C(=O)[C@@H](N)CCCCN |
| InChI | InChI=1S/C22H43N3O3/c1-3-5-7-9-11-16-20(26)25(21(27)17-12-10-8-6-4-2)22(28)19(24)15-13-14-18-23/h19H,3-18,23-24H2,1-2H3/t19-/m0/s1 |
| InChIKey | VTTJQCPMKGEEJO-IBGZPJMESA-N |
| XLogP | 4.05 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.60 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|