C13H30N2 — CID 43125906
2-N,2-N-dibutylpentane-1,2-diamine (PubChem CID 43125906) has the molecular formula C13H30N2 and a molecular weight of 214.40 g/mol. Its IUPAC name is 2-N,2-N-dibutylpentane-1,2-diamine.
| Compound Name | 2-N,2-N-dibutylpentane-1,2-diamine |
|---|---|
| PubChem CID | 43125906 |
| Molecular Formula | C13H30N2 |
| Molecular Weight | 214.40 g/mol |
| Exact Mass | 214.24 |
| IUPAC Name | 2-N,2-N-dibutylpentane-1,2-diamine |
| SMILES | CCCCN(CCCC)C(CN)CCC |
| InChI | InChI=1S/C13H30N2/c1-4-7-10-15(11-8-5-2)13(12-14)9-6-3/h13H,4-12,14H2,1-3H3 |
| InChIKey | JQFOFOANEBGIRJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.40 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |