About 1-N-tert-butyl-2-N,2-N-dibutylpentane-1,2-diamine
1-N-tert-butyl-2-N,2-N-dibutylpentane-1,2-diamine (PubChem CID 83042225) has the molecular formula C17H38N2
and a molecular weight of 270.50 g/mol. Its IUPAC name is 1-N-tert-butyl-2-N,2-N-dibutylpentane-1,2-diamine.
Molecular Properties
| Compound Name | 1-N-tert-butyl-2-N,2-N-dibutylpentane-1,2-diamine |
| PubChem CID | 83042225 |
| Molecular Formula | C17H38N2 |
| Molecular Weight | 270.50 g/mol |
| Exact Mass | 270.30 |
| IUPAC Name | 1-N-tert-butyl-2-N,2-N-dibutylpentane-1,2-diamine |
| SMILES | CCCCN(CCCC)C(CCC)CNC(C)(C)C |
| InChI | InChI=1S/C17H38N2/c1-7-10-13-19(14-11-8-2)16(12-9-3)15-18-17(4,5)6/h16,18H,7-15H2,1-6H3 |
| InChIKey | TYYUXRSEALSPJW-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-N-tert-butyl-2-N,2-N-dibutylpentane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-tert-butyl-2-N,2-N-dibutylpentane-1,2-diamine?
The IUPAC name of 1-N-tert-butyl-2-N,2-N-dibutylpentane-1,2-diamine (CID 83042225) is 1-N-tert-butyl-2-N,2-N-dibutylpentane-1,2-diamine.
What is the SMILES notation for 1-N-tert-butyl-2-N,2-N-dibutylpentane-1,2-diamine?
The canonical SMILES for 1-N-tert-butyl-2-N,2-N-dibutylpentane-1,2-diamine is CCCCN(CCCC)C(CCC)CNC(C)(C)C.
What is the InChIKey of 1-N-tert-butyl-2-N,2-N-dibutylpentane-1,2-diamine?
The InChIKey is TYYUXRSEALSPJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H38N2/c1-7-10-13-19(14-11-8-2)16(12-9-3)15-18-17(4,5)6/h16,18H,7-15H2,1-6H3.
What are the key properties of 1-N-tert-butyl-2-N,2-N-dibutylpentane-1,2-diamine?
1-N-tert-butyl-2-N,2-N-dibutylpentane-1,2-diamine has a molecular weight of 270.50 g/mol, XLogP of 4.45, 11 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-tert-butyl-2-N,2-N-dibutylpentane-1,2-diamine is sourced from PubChem (CID 83042225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).