C17H38N2 — CID 83042225
1-N-tert-butyl-2-N,2-N-dibutylpentane-1,2-diamine (PubChem CID 83042225) has the molecular formula C17H38N2 and a molecular weight of 270.50 g/mol. Its IUPAC name is 1-N-tert-butyl-2-N,2-N-dibutylpentane-1,2-diamine.
| Compound Name | 1-N-tert-butyl-2-N,2-N-dibutylpentane-1,2-diamine |
|---|---|
| PubChem CID | 83042225 |
| Molecular Formula | C17H38N2 |
| Molecular Weight | 270.50 g/mol |
| Exact Mass | 270.30 |
| IUPAC Name | 1-N-tert-butyl-2-N,2-N-dibutylpentane-1,2-diamine |
| SMILES | CCCCN(CCCC)C(CCC)CNC(C)(C)C |
| InChI | InChI=1S/C17H38N2/c1-7-10-13-19(14-11-8-2)16(12-9-3)15-18-17(4,5)6/h16,18H,7-15H2,1-6H3 |
| InChIKey | TYYUXRSEALSPJW-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |