C15H34N2 — CID 63492058
2-N,2-N-dibutyl-1-N-propylbutane-1,2-diamine (PubChem CID 63492058) has the molecular formula C15H34N2 and a molecular weight of 242.45 g/mol. Its IUPAC name is 2-N,2-N-dibutyl-1-N-propylbutane-1,2-diamine.
| Compound Name | 2-N,2-N-dibutyl-1-N-propylbutane-1,2-diamine |
|---|---|
| PubChem CID | 63492058 |
| Molecular Formula | C15H34N2 |
| Molecular Weight | 242.45 g/mol |
| Exact Mass | 242.27 |
| IUPAC Name | 2-N,2-N-dibutyl-1-N-propylbutane-1,2-diamine |
| SMILES | CCCCN(CCCC)C(CC)CNCCC |
| InChI | InChI=1S/C15H34N2/c1-5-9-12-17(13-10-6-2)15(8-4)14-16-11-7-3/h15-16H,5-14H2,1-4H3 |
| InChIKey | ITPPNBMDRZKUFZ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.45 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|