About 3-(dibutylamino)pentanal
3-(dibutylamino)pentanal (PubChem CID 22611163) has the molecular formula C13H27NO
and a molecular weight of 213.36 g/mol. Its IUPAC name is 3-(dibutylamino)pentanal.
Molecular Properties
| Compound Name | 3-(dibutylamino)pentanal |
| PubChem CID | 22611163 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | 3-(dibutylamino)pentanal |
| SMILES | CCCCN(CCCC)C(CC)CC=O |
| InChI | InChI=1S/C13H27NO/c1-4-7-10-14(11-8-5-2)13(6-3)9-12-15/h12-13H,4-11H2,1-3H3 |
| InChIKey | BVAMLTKHLUFDMJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(dibutylamino)pentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dibutylamino)pentanal?
The IUPAC name of 3-(dibutylamino)pentanal (CID 22611163) is 3-(dibutylamino)pentanal.
What is the SMILES notation for 3-(dibutylamino)pentanal?
The canonical SMILES for 3-(dibutylamino)pentanal is CCCCN(CCCC)C(CC)CC=O.
What is the InChIKey of 3-(dibutylamino)pentanal?
The InChIKey is BVAMLTKHLUFDMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO/c1-4-7-10-14(11-8-5-2)13(6-3)9-12-15/h12-13H,4-11H2,1-3H3.
What are the key properties of 3-(dibutylamino)pentanal?
3-(dibutylamino)pentanal has a molecular weight of 213.36 g/mol, XLogP of 3.26, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dibutylamino)pentanal is sourced from PubChem (CID 22611163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).