sodium 3-(didecylamino)pentanoate

C25H50NNaO2 — CID 101314087

IUPACsodium 3-(didecylamino)pentanoate
SMILESCCCCCCCCCCN(CCCCCCCCCC)C(CC)CC(=O)[O-].[Na+]
InChIInChI=1S/C25H51NO2.Na/c1-4-7-9-11-13-15-17-19-21-26(24(6-3)23-25(27)28)22-20-18-16-14-12-10-8-5-2;/h24H,4-23H2,1-3H3,(H,27,28);/q;+1/p-1
InChIKeyCDNRNUZZYHUNGV-UHFFFAOYSA-M
MW419.67 g/mol
LogP3.49
Rot. Bonds22

About sodium 3-(didecylamino)pentanoate

sodium 3-(didecylamino)pentanoate (PubChem CID 101314087) has the molecular formula C25H50NNaO2 and a molecular weight of 419.67 g/mol. Its IUPAC name is sodium 3-(didecylamino)pentanoate.

Molecular Properties

Compound Namesodium 3-(didecylamino)pentanoate
PubChem CID101314087
Molecular FormulaC25H50NNaO2
Molecular Weight419.67 g/mol
Exact Mass419.37
IUPAC Namesodium 3-(didecylamino)pentanoate
SMILESCCCCCCCCCCN(CCCCCCCCCC)C(CC)CC(=O)[O-].[Na+]
InChIInChI=1S/C25H51NO2.Na/c1-4-7-9-11-13-15-17-19-21-26(24(6-3)23-25(27)28)22-20-18-16-14-12-10-8-5-2;/h24H,4-23H2,1-3H3,(H,27,28);/q;+1/p-1
InChIKeyCDNRNUZZYHUNGV-UHFFFAOYSA-M
XLogP3.49
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds22
Heavy Atoms29
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500419.67
LogP ≤ 53.49
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze sodium 3-(didecylamino)pentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

sodium 3-[di(heptadecyl)amino]pentanoate
CID 101314227
potassium 3-[di(icosyl)amino]pentanoate
CID 101314286
sodium 3-[di(undecyl)amino]hexanoate
CID 101314437
calcium bis(3-[di(tridecyl)amino]hexanoate)
CID 101314487
sodium 4-(didecylamino)hexanoate
CID 101314417
sodium 4-(dioctylamino)hexanoate
CID 101313492
sodium 3-(dioctylamino)butanoate
CID 101313453
sodium 3-[di(pentadecyl)amino]butanoate
CID 101313917
calcium bis(4-[di(tricosyl)amino]hexanoate)
CID 101314742
potassium 4-[di(tetracosyl)amino]hexanoate
CID 101314765
calcium bis(4-[di(tetradecyl)amino]hexanoate)
CID 101314517
lithium 4-[di(tridecyl)amino]hexanoate
CID 101314489

Frequently Asked Questions

What is the IUPAC name of sodium 3-(didecylamino)pentanoate?
The IUPAC name of sodium 3-(didecylamino)pentanoate (CID 101314087) is sodium 3-(didecylamino)pentanoate.
What is the SMILES notation for sodium 3-(didecylamino)pentanoate?
The canonical SMILES for sodium 3-(didecylamino)pentanoate is CCCCCCCCCCN(CCCCCCCCCC)C(CC)CC(=O)[O-].[Na+].
What is the InChIKey of sodium 3-(didecylamino)pentanoate?
The InChIKey is CDNRNUZZYHUNGV-UHFFFAOYSA-M. The full InChI is InChI=1S/C25H51NO2.Na/c1-4-7-9-11-13-15-17-19-21-26(24(6-3)23-25(27)28)22-20-18-16-14-12-10-8-5-2;/h24H,4-23H2,1-3H3,(H,27,28);/q;+1/p-1.
What are the key properties of sodium 3-(didecylamino)pentanoate?
sodium 3-(didecylamino)pentanoate has a molecular weight of 419.67 g/mol, XLogP of 3.49, 22 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 3-(didecylamino)pentanoate is sourced from PubChem (CID 101314087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).