sodium 3-(dioctylamino)butanoate

C20H40NNaO2 — CID 101313453

IUPACsodium 3-(dioctylamino)butanoate
SMILESCCCCCCCCN(CCCCCCCC)C(C)CC(=O)[O-].[Na+]
InChIInChI=1S/C20H41NO2.Na/c1-4-6-8-10-12-14-16-21(19(3)18-20(22)23)17-15-13-11-9-7-5-2;/h19H,4-18H2,1-3H3,(H,22,23);/q;+1/p-1
InChIKeyDPDILANSGSESSQ-UHFFFAOYSA-M
MW349.54 g/mol
LogP1.54
Rot. Bonds17

About sodium 3-(dioctylamino)butanoate

sodium 3-(dioctylamino)butanoate (PubChem CID 101313453) has the molecular formula C20H40NNaO2 and a molecular weight of 349.54 g/mol. Its IUPAC name is sodium 3-(dioctylamino)butanoate.

Molecular Properties

Compound Namesodium 3-(dioctylamino)butanoate
PubChem CID101313453
Molecular FormulaC20H40NNaO2
Molecular Weight349.54 g/mol
Exact Mass349.30
IUPAC Namesodium 3-(dioctylamino)butanoate
SMILESCCCCCCCCN(CCCCCCCC)C(C)CC(=O)[O-].[Na+]
InChIInChI=1S/C20H41NO2.Na/c1-4-6-8-10-12-14-16-21(19(3)18-20(22)23)17-15-13-11-9-7-5-2;/h19H,4-18H2,1-3H3,(H,22,23);/q;+1/p-1
InChIKeyDPDILANSGSESSQ-UHFFFAOYSA-M
XLogP1.54
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds17
Heavy Atoms24
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500349.54
LogP ≤ 51.54
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze sodium 3-(dioctylamino)butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

sodium 3-[di(pentadecyl)amino]butanoate
CID 101313917
potassium 3-[di(tetradecyl)amino]butanoate
CID 101313901
potassium 3-(dioctadecylamino)butanoate
CID 101313961
potassium 3-[di(pentadecyl)amino]butanoate
CID 101313916
calcium bis(3-[di(tricosyl)amino]butanoate)
CID 101314038
sodium 3-(didecylamino)pentanoate
CID 101314087
sodium 3-[di(heptadecyl)amino]pentanoate
CID 101314227
3-[di(icosyl)amino]butanoic acid
CID 101313989
3-(dioctylamino)butanoic acid
CID 101313450
sodium 5-[di(pentadecyl)amino]hexanoate
CID 101314546
sodium 3-[di(undecyl)amino]hexanoate
CID 101314437
sodium 2-(didecylamino)propanoate
CID 101313681

Frequently Asked Questions

What is the IUPAC name of sodium 3-(dioctylamino)butanoate?
The IUPAC name of sodium 3-(dioctylamino)butanoate (CID 101313453) is sodium 3-(dioctylamino)butanoate.
What is the SMILES notation for sodium 3-(dioctylamino)butanoate?
The canonical SMILES for sodium 3-(dioctylamino)butanoate is CCCCCCCCN(CCCCCCCC)C(C)CC(=O)[O-].[Na+].
What is the InChIKey of sodium 3-(dioctylamino)butanoate?
The InChIKey is DPDILANSGSESSQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C20H41NO2.Na/c1-4-6-8-10-12-14-16-21(19(3)18-20(22)23)17-15-13-11-9-7-5-2;/h19H,4-18H2,1-3H3,(H,22,23);/q;+1/p-1.
What are the key properties of sodium 3-(dioctylamino)butanoate?
sodium 3-(dioctylamino)butanoate has a molecular weight of 349.54 g/mol, XLogP of 1.54, 17 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 3-(dioctylamino)butanoate is sourced from PubChem (CID 101313453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).