C21H45N — CID 139649762
N,N-dibutyltridecan-4-amine (PubChem CID 139649762) has the molecular formula C21H45N and a molecular weight of 311.60 g/mol. Its IUPAC name is N,N-dibutyltridecan-4-amine.
| Compound Name | N,N-dibutyltridecan-4-amine |
|---|---|
| PubChem CID | 139649762 |
| Molecular Formula | C21H45N |
| Molecular Weight | 311.60 g/mol |
| Exact Mass | 311.36 |
| IUPAC Name | N,N-dibutyltridecan-4-amine |
| SMILES | CCCCCCCCCC(CCC)N(CCCC)CCCC |
| InChI | InChI=1S/C21H45N/c1-5-9-12-13-14-15-16-18-21(17-8-4)22(19-10-6-2)20-11-7-3/h21H,5-20H2,1-4H3 |
| InChIKey | AEJPSTMTJGPUSO-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.60 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|