C16H36N2O — CID 55072208
N'-(2-methoxyethyl)-N-(2-methylpropyl)-N'-pentan-3-ylbutane-1,4-diamine (PubChem CID 55072208) has the molecular formula C16H36N2O and a molecular weight of 272.48 g/mol. Its IUPAC name is N'-(2-methoxyethyl)-N-(2-methylpropyl)-N'-pentan-3-ylbutane-1,4-diamine.
| Compound Name | N'-(2-methoxyethyl)-N-(2-methylpropyl)-N'-pentan-3-ylbutane-1,4-diamine |
|---|---|
| PubChem CID | 55072208 |
| Molecular Formula | C16H36N2O |
| Molecular Weight | 272.48 g/mol |
| Exact Mass | 272.28 |
| IUPAC Name | N'-(2-methoxyethyl)-N-(2-methylpropyl)-N'-pentan-3-ylbutane-1,4-diamine |
| SMILES | CCC(CC)N(CCCCNCC(C)C)CCOC |
| InChI | InChI=1S/C16H36N2O/c1-6-16(7-2)18(12-13-19-5)11-9-8-10-17-14-15(3)4/h15-17H,6-14H2,1-5H3 |
| InChIKey | IFHZWBKCVJZYLQ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|