C14H32N2O2 — CID 62557564
N'-(2-methoxyethyl)-N-(3-methoxypropyl)-N'-pentan-3-ylethane-1,2-diamine (PubChem CID 62557564) has the molecular formula C14H32N2O2 and a molecular weight of 260.42 g/mol. Its IUPAC name is N'-(2-methoxyethyl)-N-(3-methoxypropyl)-N'-pentan-3-ylethane-1,2-diamine.
| Compound Name | N'-(2-methoxyethyl)-N-(3-methoxypropyl)-N'-pentan-3-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 62557564 |
| Molecular Formula | C14H32N2O2 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.25 |
| IUPAC Name | N'-(2-methoxyethyl)-N-(3-methoxypropyl)-N'-pentan-3-ylethane-1,2-diamine |
| SMILES | CCC(CC)N(CCNCCCOC)CCOC |
| InChI | InChI=1S/C14H32N2O2/c1-5-14(6-2)16(11-13-18-4)10-9-15-8-7-12-17-3/h14-15H,5-13H2,1-4H3 |
| InChIKey | CGVJTIVGFNGTJP-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|