C24H60N2 — CID 155599553
2-N,2-N-dimethyl-1-N-octylbutane-1,2-diamine;ethane;propane (PubChem CID 155599553) has the molecular formula C24H60N2 and a molecular weight of 376.76 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-1-N-octylbutane-1,2-diamine;ethane;propane.
| Compound Name | 2-N,2-N-dimethyl-1-N-octylbutane-1,2-diamine;ethane;propane |
|---|---|
| PubChem CID | 155599553 |
| Molecular Formula | C24H60N2 |
| Molecular Weight | 376.76 g/mol |
| Exact Mass | 376.48 |
| IUPAC Name | 2-N,2-N-dimethyl-1-N-octylbutane-1,2-diamine;ethane;propane |
| SMILES | CC.CC.CCC.CCC.CCCCCCCCNCC(CC)N(C)C |
| InChI | InChI=1S/C14H32N2.2C3H8.2C2H6/c1-5-7-8-9-10-11-12-15-13-14(6-2)16(3)4;2*1-3-2;2*1-2/h14-15H,5-13H2,1-4H3;2*3H2,1-2H3;2*1-2H3 |
| InChIKey | QNONYCWOOYDNGH-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.76 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|