About N-decyl-N'-(2-methylpropyl)ethane-1,2-diamine
N-decyl-N'-(2-methylpropyl)ethane-1,2-diamine (PubChem CID 113405465) has the molecular formula C16H36N2
and a molecular weight of 256.48 g/mol. Its IUPAC name is N-decyl-N'-(2-methylpropyl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N-decyl-N'-(2-methylpropyl)ethane-1,2-diamine |
| PubChem CID | 113405465 |
| Molecular Formula | C16H36N2 |
| Molecular Weight | 256.48 g/mol |
| Exact Mass | 256.29 |
| IUPAC Name | N-decyl-N'-(2-methylpropyl)ethane-1,2-diamine |
| SMILES | CCCCCCCCCCNCCNCC(C)C |
| InChI | InChI=1S/C16H36N2/c1-4-5-6-7-8-9-10-11-12-17-13-14-18-15-16(2)3/h16-18H,4-15H2,1-3H3 |
| InChIKey | CPUHEGUVDJCZBD-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-decyl-N'-(2-methylpropyl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-decyl-N'-(2-methylpropyl)ethane-1,2-diamine?
The IUPAC name of N-decyl-N'-(2-methylpropyl)ethane-1,2-diamine (CID 113405465) is N-decyl-N'-(2-methylpropyl)ethane-1,2-diamine.
What is the SMILES notation for N-decyl-N'-(2-methylpropyl)ethane-1,2-diamine?
The canonical SMILES for N-decyl-N'-(2-methylpropyl)ethane-1,2-diamine is CCCCCCCCCCNCCNCC(C)C.
What is the InChIKey of N-decyl-N'-(2-methylpropyl)ethane-1,2-diamine?
The InChIKey is CPUHEGUVDJCZBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H36N2/c1-4-5-6-7-8-9-10-11-12-17-13-14-18-15-16(2)3/h16-18H,4-15H2,1-3H3.
What are the key properties of N-decyl-N'-(2-methylpropyl)ethane-1,2-diamine?
N-decyl-N'-(2-methylpropyl)ethane-1,2-diamine has a molecular weight of 256.48 g/mol, XLogP of 3.96, 14 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-decyl-N'-(2-methylpropyl)ethane-1,2-diamine is sourced from PubChem (CID 113405465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).