C14H34N4 — CID 54452976
N,N'-bis[2-(2-methylpropylamino)ethyl]ethane-1,2-diamine (PubChem CID 54452976) has the molecular formula C14H34N4 and a molecular weight of 258.45 g/mol. Its IUPAC name is N,N'-bis[2-(2-methylpropylamino)ethyl]ethane-1,2-diamine.
| Compound Name | N,N'-bis[2-(2-methylpropylamino)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 54452976 |
| Molecular Formula | C14H34N4 |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.28 |
| IUPAC Name | N,N'-bis[2-(2-methylpropylamino)ethyl]ethane-1,2-diamine |
| SMILES | CC(C)CNCCNCCNCCNCC(C)C |
| InChI | InChI=1S/C14H34N4/c1-13(2)11-17-9-7-15-5-6-16-8-10-18-12-14(3)4/h13-18H,5-12H2,1-4H3 |
| InChIKey | WWFNCLWDMUUEJD-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|