C18H42N4 — CID 101082542
N-(2-methylpropyl)-N',N'-bis[2-(2-methylpropylamino)ethyl]ethane-1,2-diamine (PubChem CID 101082542) has the molecular formula C18H42N4 and a molecular weight of 314.56 g/mol. Its IUPAC name is N-(2-methylpropyl)-N',N'-bis[2-(2-methylpropylamino)ethyl]ethane-1,2-diamine.
| Compound Name | N-(2-methylpropyl)-N',N'-bis[2-(2-methylpropylamino)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 101082542 |
| Molecular Formula | C18H42N4 |
| Molecular Weight | 314.56 g/mol |
| Exact Mass | 314.34 |
| IUPAC Name | N-(2-methylpropyl)-N',N'-bis[2-(2-methylpropylamino)ethyl]ethane-1,2-diamine |
| SMILES | CC(C)CNCCN(CCNCC(C)C)CCNCC(C)C |
| InChI | InChI=1S/C18H42N4/c1-16(2)13-19-7-10-22(11-8-20-14-17(3)4)12-9-21-15-18(5)6/h16-21H,7-15H2,1-6H3 |
| InChIKey | MVHJOLSKIZRDEU-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 39.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.56 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|