C12H29N3 — CID 63725817
N,N,N'-trimethyl-N'-[2-(2-methylpropylamino)ethyl]propane-1,3-diamine (PubChem CID 63725817) has the molecular formula C12H29N3 and a molecular weight of 215.38 g/mol. Its IUPAC name is N,N,N'-trimethyl-N'-[2-(2-methylpropylamino)ethyl]propane-1,3-diamine.
| Compound Name | N,N,N'-trimethyl-N'-[2-(2-methylpropylamino)ethyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 63725817 |
| Molecular Formula | C12H29N3 |
| Molecular Weight | 215.38 g/mol |
| Exact Mass | 215.24 |
| IUPAC Name | N,N,N'-trimethyl-N'-[2-(2-methylpropylamino)ethyl]propane-1,3-diamine |
| SMILES | CC(C)CNCCN(C)CCCN(C)C |
| InChI | InChI=1S/C12H29N3/c1-12(2)11-13-7-10-15(5)9-6-8-14(3)4/h12-13H,6-11H2,1-5H3 |
| InChIKey | UWZBDCNEQZYLPV-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.38 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|