C16H36N2 — CID 63527329
N'-methyl-N-(2-methylpropyl)-N'-nonylethane-1,2-diamine (PubChem CID 63527329) has the molecular formula C16H36N2 and a molecular weight of 256.48 g/mol. Its IUPAC name is N'-methyl-N-(2-methylpropyl)-N'-nonylethane-1,2-diamine.
| Compound Name | N'-methyl-N-(2-methylpropyl)-N'-nonylethane-1,2-diamine |
|---|---|
| PubChem CID | 63527329 |
| Molecular Formula | C16H36N2 |
| Molecular Weight | 256.48 g/mol |
| Exact Mass | 256.29 |
| IUPAC Name | N'-methyl-N-(2-methylpropyl)-N'-nonylethane-1,2-diamine |
| SMILES | CCCCCCCCCN(C)CCNCC(C)C |
| InChI | InChI=1S/C16H36N2/c1-5-6-7-8-9-10-11-13-18(4)14-12-17-15-16(2)3/h16-17H,5-15H2,1-4H3 |
| InChIKey | KWTCKJAZJGQICW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|