C16H36N2 — CID 43130327
3-ethyl-1-N-heptyl-2-N,2-N-dimethylpentane-1,2-diamine (PubChem CID 43130327) has the molecular formula C16H36N2 and a molecular weight of 256.48 g/mol. Its IUPAC name is 3-ethyl-1-N-heptyl-2-N,2-N-dimethylpentane-1,2-diamine.
| Compound Name | 3-ethyl-1-N-heptyl-2-N,2-N-dimethylpentane-1,2-diamine |
|---|---|
| PubChem CID | 43130327 |
| Molecular Formula | C16H36N2 |
| Molecular Weight | 256.48 g/mol |
| Exact Mass | 256.29 |
| IUPAC Name | 3-ethyl-1-N-heptyl-2-N,2-N-dimethylpentane-1,2-diamine |
| SMILES | CCCCCCCNCC(C(CC)CC)N(C)C |
| InChI | InChI=1S/C16H36N2/c1-6-9-10-11-12-13-17-14-16(18(4)5)15(7-2)8-3/h15-17H,6-14H2,1-5H3 |
| InChIKey | IBMZULOVBSZIBG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|