C22H48N2 — CID 142627498
2-N,2-N-diethyloctadecane-1,2-diamine (PubChem CID 142627498) has the molecular formula C22H48N2 and a molecular weight of 340.64 g/mol. Its IUPAC name is 2-N,2-N-diethyloctadecane-1,2-diamine.
| Compound Name | 2-N,2-N-diethyloctadecane-1,2-diamine |
|---|---|
| PubChem CID | 142627498 |
| Molecular Formula | C22H48N2 |
| Molecular Weight | 340.64 g/mol |
| Exact Mass | 340.38 |
| IUPAC Name | 2-N,2-N-diethyloctadecane-1,2-diamine |
| SMILES | CCCCCCCCCCCCCCCCC(CN)N(CC)CC |
| InChI | InChI=1S/C22H48N2/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22(21-23)24(5-2)6-3/h22H,4-21,23H2,1-3H3 |
| InChIKey | LAJZECCBYRTYST-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.64 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|