C13H30N2O — CID 61448149
2-N-ethyl-2-N-(2-methoxyethyl)octane-1,2-diamine (PubChem CID 61448149) has the molecular formula C13H30N2O and a molecular weight of 230.40 g/mol. Its IUPAC name is 2-N-ethyl-2-N-(2-methoxyethyl)octane-1,2-diamine.
| Compound Name | 2-N-ethyl-2-N-(2-methoxyethyl)octane-1,2-diamine |
|---|---|
| PubChem CID | 61448149 |
| Molecular Formula | C13H30N2O |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.24 |
| IUPAC Name | 2-N-ethyl-2-N-(2-methoxyethyl)octane-1,2-diamine |
| SMILES | CCCCCCC(CN)N(CC)CCOC |
| InChI | InChI=1S/C13H30N2O/c1-4-6-7-8-9-13(12-14)15(5-2)10-11-16-3/h13H,4-12,14H2,1-3H3 |
| InChIKey | MVFFXWCORJSZDI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|