C12H28N2O — CID 61427745
2-N-(2-methoxyethyl)-2-N-methyloctane-1,2-diamine (PubChem CID 61427745) has the molecular formula C12H28N2O and a molecular weight of 216.37 g/mol. Its IUPAC name is 2-N-(2-methoxyethyl)-2-N-methyloctane-1,2-diamine.
| Compound Name | 2-N-(2-methoxyethyl)-2-N-methyloctane-1,2-diamine |
|---|---|
| PubChem CID | 61427745 |
| Molecular Formula | C12H28N2O |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.22 |
| IUPAC Name | 2-N-(2-methoxyethyl)-2-N-methyloctane-1,2-diamine |
| SMILES | CCCCCCC(CN)N(C)CCOC |
| InChI | InChI=1S/C12H28N2O/c1-4-5-6-7-8-12(11-13)14(2)9-10-15-3/h12H,4-11,13H2,1-3H3 |
| InChIKey | QHUAESCUQPJJFZ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|