C15H34N2 — CID 55193416
2-N-methyl-2-N-(3-methylbutyl)nonane-1,2-diamine (PubChem CID 55193416) has the molecular formula C15H34N2 and a molecular weight of 242.45 g/mol. Its IUPAC name is 2-N-methyl-2-N-(3-methylbutyl)nonane-1,2-diamine.
| Compound Name | 2-N-methyl-2-N-(3-methylbutyl)nonane-1,2-diamine |
|---|---|
| PubChem CID | 55193416 |
| Molecular Formula | C15H34N2 |
| Molecular Weight | 242.45 g/mol |
| Exact Mass | 242.27 |
| IUPAC Name | 2-N-methyl-2-N-(3-methylbutyl)nonane-1,2-diamine |
| SMILES | CCCCCCCC(CN)N(C)CCC(C)C |
| InChI | InChI=1S/C15H34N2/c1-5-6-7-8-9-10-15(13-16)17(4)12-11-14(2)3/h14-15H,5-13,16H2,1-4H3 |
| InChIKey | JGTXOHXBPSWFPM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|