C10H24N2 — CID 43137443
N'-butan-2-yl-N'-propan-2-ylpropane-1,3-diamine (PubChem CID 43137443) has the molecular formula C10H24N2 and a molecular weight of 172.32 g/mol. Its IUPAC name is N'-butan-2-yl-N'-propan-2-ylpropane-1,3-diamine.
| Compound Name | N'-butan-2-yl-N'-propan-2-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 43137443 |
| Molecular Formula | C10H24N2 |
| Molecular Weight | 172.32 g/mol |
| Exact Mass | 172.19 |
| IUPAC Name | N'-butan-2-yl-N'-propan-2-ylpropane-1,3-diamine |
| SMILES | CCC(C)N(CCCN)C(C)C |
| InChI | InChI=1S/C10H24N2/c1-5-10(4)12(9(2)3)8-6-7-11/h9-10H,5-8,11H2,1-4H3 |
| InChIKey | FEDDJHRRWOMXHR-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.32 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |