C8H20N2O — CID 174501653
N'-butan-2-yl-N'-methoxypropane-1,3-diamine (PubChem CID 174501653) has the molecular formula C8H20N2O and a molecular weight of 160.26 g/mol. Its IUPAC name is N'-butan-2-yl-N'-methoxypropane-1,3-diamine.
| Compound Name | N'-butan-2-yl-N'-methoxypropane-1,3-diamine |
|---|---|
| PubChem CID | 174501653 |
| Molecular Formula | C8H20N2O |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.16 |
| IUPAC Name | N'-butan-2-yl-N'-methoxypropane-1,3-diamine |
| SMILES | CCC(C)N(CCCN)OC |
| InChI | InChI=1S/C8H20N2O/c1-4-8(2)10(11-3)7-5-6-9/h8H,4-7,9H2,1-3H3 |
| InChIKey | JZLHBZXODQJOLF-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|