C14H30N2 — CID 43137687
N'-butan-2-yl-N'-cycloheptylpropane-1,3-diamine (PubChem CID 43137687) has the molecular formula C14H30N2 and a molecular weight of 226.41 g/mol. Its IUPAC name is N'-butan-2-yl-N'-cycloheptylpropane-1,3-diamine.
| Compound Name | N'-butan-2-yl-N'-cycloheptylpropane-1,3-diamine |
|---|---|
| PubChem CID | 43137687 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | N'-butan-2-yl-N'-cycloheptylpropane-1,3-diamine |
| SMILES | CCC(C)N(CCCN)C1CCCCCC1 |
| InChI | InChI=1S/C14H30N2/c1-3-13(2)16(12-8-11-15)14-9-6-4-5-7-10-14/h13-14H,3-12,15H2,1-2H3 |
| InChIKey | IEEFCSJVFUAVKA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |