About N'-cyclohexyl-N'-propan-2-ylmethanediamine
N'-cyclohexyl-N'-propan-2-ylmethanediamine (PubChem CID 54225013) has the molecular formula C10H22N2
and a molecular weight of 170.30 g/mol. Its IUPAC name is N'-cyclohexyl-N'-propan-2-ylmethanediamine.
Molecular Properties
| Compound Name | N'-cyclohexyl-N'-propan-2-ylmethanediamine |
| PubChem CID | 54225013 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | N'-cyclohexyl-N'-propan-2-ylmethanediamine |
| SMILES | CC(C)N(CN)C1CCCCC1 |
| InChI | InChI=1S/C10H22N2/c1-9(2)12(8-11)10-6-4-3-5-7-10/h9-10H,3-8,11H2,1-2H3 |
| InChIKey | YLHYQVLUWZNDFH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N'-cyclohexyl-N'-propan-2-ylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-cyclohexyl-N'-propan-2-ylmethanediamine?
The IUPAC name of N'-cyclohexyl-N'-propan-2-ylmethanediamine (CID 54225013) is N'-cyclohexyl-N'-propan-2-ylmethanediamine.
What is the SMILES notation for N'-cyclohexyl-N'-propan-2-ylmethanediamine?
The canonical SMILES for N'-cyclohexyl-N'-propan-2-ylmethanediamine is CC(C)N(CN)C1CCCCC1.
What is the InChIKey of N'-cyclohexyl-N'-propan-2-ylmethanediamine?
The InChIKey is YLHYQVLUWZNDFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2/c1-9(2)12(8-11)10-6-4-3-5-7-10/h9-10H,3-8,11H2,1-2H3.
What are the key properties of N'-cyclohexyl-N'-propan-2-ylmethanediamine?
N'-cyclohexyl-N'-propan-2-ylmethanediamine has a molecular weight of 170.30 g/mol, XLogP of 1.95, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-cyclohexyl-N'-propan-2-ylmethanediamine is sourced from PubChem (CID 54225013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).