About N-ethyl-N-propan-2-ylcyclohexanamine;iodomethane
N-ethyl-N-propan-2-ylcyclohexanamine;iodomethane (PubChem CID 143070375) has the molecular formula C12H26IN
and a molecular weight of 311.25 g/mol. Its IUPAC name is N-ethyl-N-propan-2-ylcyclohexanamine;iodomethane.
Molecular Properties
| Compound Name | N-ethyl-N-propan-2-ylcyclohexanamine;iodomethane |
| PubChem CID | 143070375 |
| Molecular Formula | C12H26IN |
| Molecular Weight | 311.25 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | N-ethyl-N-propan-2-ylcyclohexanamine;iodomethane |
| SMILES | CCN(C(C)C)C1CCCCC1.CI |
| InChI | InChI=1S/C11H23N.CH3I/c1-4-12(10(2)3)11-8-6-5-7-9-11;1-2/h10-11H,4-9H2,1-3H3;1H3 |
| InChIKey | INUREUULMNIWDJ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.25 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N-propan-2-ylcyclohexanamine;iodomethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-propan-2-ylcyclohexanamine;iodomethane?
The IUPAC name of N-ethyl-N-propan-2-ylcyclohexanamine;iodomethane (CID 143070375) is N-ethyl-N-propan-2-ylcyclohexanamine;iodomethane.
What is the SMILES notation for N-ethyl-N-propan-2-ylcyclohexanamine;iodomethane?
The canonical SMILES for N-ethyl-N-propan-2-ylcyclohexanamine;iodomethane is CCN(C(C)C)C1CCCCC1.CI.
What is the InChIKey of N-ethyl-N-propan-2-ylcyclohexanamine;iodomethane?
The InChIKey is INUREUULMNIWDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N.CH3I/c1-4-12(10(2)3)11-8-6-5-7-9-11;1-2/h10-11H,4-9H2,1-3H3;1H3.
What are the key properties of N-ethyl-N-propan-2-ylcyclohexanamine;iodomethane?
N-ethyl-N-propan-2-ylcyclohexanamine;iodomethane has a molecular weight of 311.25 g/mol, XLogP of 4.10, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-propan-2-ylcyclohexanamine;iodomethane is sourced from PubChem (CID 143070375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).