C8H22N4 — CID 87162655
N',N'-bis(1-aminoethyl)butane-1,4-diamine (PubChem CID 87162655) has the molecular formula C8H22N4 and a molecular weight of 174.29 g/mol. Its IUPAC name is N',N'-bis(1-aminoethyl)butane-1,4-diamine.
| Compound Name | N',N'-bis(1-aminoethyl)butane-1,4-diamine |
|---|---|
| PubChem CID | 87162655 |
| Molecular Formula | C8H22N4 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.18 |
| IUPAC Name | N',N'-bis(1-aminoethyl)butane-1,4-diamine |
| SMILES | CC(N)N(CCCCN)C(C)N |
| InChI | InChI=1S/C8H22N4/c1-7(10)12(8(2)11)6-4-3-5-9/h7-8H,3-6,9-11H2,1-2H3 |
| InChIKey | KOJSGELUOKHBEC-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|