About N'-(3-aminopropyl)-N'-(2-methylpropyl)butane-1,4-diamine
N'-(3-aminopropyl)-N'-(2-methylpropyl)butane-1,4-diamine (PubChem CID 86269595) has the molecular formula C11H27N3
and a molecular weight of 201.36 g/mol. Its IUPAC name is N'-(3-aminopropyl)-N'-(2-methylpropyl)butane-1,4-diamine.
Molecular Properties
| Compound Name | N'-(3-aminopropyl)-N'-(2-methylpropyl)butane-1,4-diamine |
| PubChem CID | 86269595 |
| Molecular Formula | C11H27N3 |
| Molecular Weight | 201.36 g/mol |
| Exact Mass | 201.22 |
| IUPAC Name | N'-(3-aminopropyl)-N'-(2-methylpropyl)butane-1,4-diamine |
| SMILES | CC(C)CN(CCCN)CCCCN |
| InChI | InChI=1S/C11H27N3/c1-11(2)10-14(9-5-7-13)8-4-3-6-12/h11H,3-10,12-13H2,1-2H3 |
| InChIKey | YCNKGIQJQLHPKB-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.36 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-(3-aminopropyl)-N'-(2-methylpropyl)butane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(3-aminopropyl)-N'-(2-methylpropyl)butane-1,4-diamine?
The IUPAC name of N'-(3-aminopropyl)-N'-(2-methylpropyl)butane-1,4-diamine (CID 86269595) is N'-(3-aminopropyl)-N'-(2-methylpropyl)butane-1,4-diamine.
What is the SMILES notation for N'-(3-aminopropyl)-N'-(2-methylpropyl)butane-1,4-diamine?
The canonical SMILES for N'-(3-aminopropyl)-N'-(2-methylpropyl)butane-1,4-diamine is CC(C)CN(CCCN)CCCCN.
What is the InChIKey of N'-(3-aminopropyl)-N'-(2-methylpropyl)butane-1,4-diamine?
The InChIKey is YCNKGIQJQLHPKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H27N3/c1-11(2)10-14(9-5-7-13)8-4-3-6-12/h11H,3-10,12-13H2,1-2H3.
What are the key properties of N'-(3-aminopropyl)-N'-(2-methylpropyl)butane-1,4-diamine?
N'-(3-aminopropyl)-N'-(2-methylpropyl)butane-1,4-diamine has a molecular weight of 201.36 g/mol, XLogP of 1.03, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(3-aminopropyl)-N'-(2-methylpropyl)butane-1,4-diamine is sourced from PubChem (CID 86269595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).