C9H23N3O — CID 88627199
1-[bis(3-aminopropyl)amino]propan-2-ol (PubChem CID 88627199) has the molecular formula C9H23N3O and a molecular weight of 189.30 g/mol. Its IUPAC name is 1-[bis(3-aminopropyl)amino]propan-2-ol.
| Compound Name | 1-[bis(3-aminopropyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 88627199 |
| Molecular Formula | C9H23N3O |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.18 |
| IUPAC Name | 1-[bis(3-aminopropyl)amino]propan-2-ol |
| SMILES | CC(O)CN(CCCN)CCCN |
| InChI | InChI=1S/C9H23N3O/c1-9(13)8-12(6-2-4-10)7-3-5-11/h9,13H,2-8,10-11H2,1H3 |
| InChIKey | WEIRVTXRIQXHDZ-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 75.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |