C7H21N3O — CID 174810904
1-(dimethylamino)propan-2-ol;ethane-1,2-diamine (PubChem CID 174810904) has the molecular formula C7H21N3O and a molecular weight of 163.26 g/mol. Its IUPAC name is 1-(dimethylamino)propan-2-ol;ethane-1,2-diamine.
| Compound Name | 1-(dimethylamino)propan-2-ol;ethane-1,2-diamine |
|---|---|
| PubChem CID | 174810904 |
| Molecular Formula | C7H21N3O |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.17 |
| IUPAC Name | 1-(dimethylamino)propan-2-ol;ethane-1,2-diamine |
| SMILES | CC(O)CN(C)C.NCCN |
| InChI | InChI=1S/C5H13NO.C2H8N2/c1-5(7)4-6(2)3;3-1-2-4/h5,7H,4H2,1-3H3;1-4H2 |
| InChIKey | VAQGLQKYDZRVTR-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 75.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |