C11H26N2O2 — CID 87581413
1-[3-(dimethylamino)propyl-[(2R)-2-hydroxypropyl]amino]propan-2-ol (PubChem CID 87581413) has the molecular formula C11H26N2O2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 1-[3-(dimethylamino)propyl-[(2R)-2-hydroxypropyl]amino]propan-2-ol.
| Compound Name | 1-[3-(dimethylamino)propyl-[(2R)-2-hydroxypropyl]amino]propan-2-ol |
|---|---|
| PubChem CID | 87581413 |
| Molecular Formula | C11H26N2O2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | 1-[3-(dimethylamino)propyl-[(2R)-2-hydroxypropyl]amino]propan-2-ol |
| SMILES | CC(O)CN(CCCN(C)C)C[C@@H](C)O |
| InChI | InChI=1S/C11H26N2O2/c1-10(14)8-13(9-11(2)15)7-5-6-12(3)4/h10-11,14-15H,5-9H2,1-4H3/t10-,11?/m1/s1 |
| InChIKey | FFCUXTGIVGMUKC-NFJWQWPMSA-N |
| XLogP | 0.00 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |