C26H52N2O6S2 — CID 170393017
S-[3-[5-[bis(2-hydroxypropyl)amino]pentanoylsulfanyl]butan-2-yl] 5-[bis(2-hydroxypropyl)amino]pentanethioate (PubChem CID 170393017) has the molecular formula C26H52N2O6S2 and a molecular weight of 552.84 g/mol. Its IUPAC name is S-[3-[5-[bis(2-hydroxypropyl)amino]pentanoylsulfanyl]butan-2-yl] 5-[bis(2-hydroxypropyl)amino]pentanethioate.
| Compound Name | S-[3-[5-[bis(2-hydroxypropyl)amino]pentanoylsulfanyl]butan-2-yl] 5-[bis(2-hydroxypropyl)amino]pentanethioate |
|---|---|
| PubChem CID | 170393017 |
| Molecular Formula | C26H52N2O6S2 |
| Molecular Weight | 552.84 g/mol |
| Exact Mass | 552.33 |
| IUPAC Name | S-[3-[5-[bis(2-hydroxypropyl)amino]pentanoylsulfanyl]butan-2-yl] 5-[bis(2-hydroxypropyl)amino]pentanethioate |
| SMILES | CC(O)CN(CCCCC(=O)SC(C)C(C)SC(=O)CCCCN(CC(C)O)CC(C)O)CC(C)O |
| InChI | InChI=1S/C26H52N2O6S2/c1-19(29)15-27(16-20(2)30)13-9-7-11-25(33)35-23(5)24(6)36-26(34)12-8-10-14-28(17-21(3)31)18-22(4)32/h19-24,29-32H,7-18H2,1-6H3 |
| InChIKey | FUBJYDBSOVYSAS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 121.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.84 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|