C12H28N2 — CID 43572239
N'-methyl-N'-pentan-2-ylhexane-1,6-diamine (PubChem CID 43572239) has the molecular formula C12H28N2 and a molecular weight of 200.37 g/mol. Its IUPAC name is N'-methyl-N'-pentan-2-ylhexane-1,6-diamine.
| Compound Name | N'-methyl-N'-pentan-2-ylhexane-1,6-diamine |
|---|---|
| PubChem CID | 43572239 |
| Molecular Formula | C12H28N2 |
| Molecular Weight | 200.37 g/mol |
| Exact Mass | 200.23 |
| IUPAC Name | N'-methyl-N'-pentan-2-ylhexane-1,6-diamine |
| SMILES | CCCC(C)N(C)CCCCCCN |
| InChI | InChI=1S/C12H28N2/c1-4-9-12(2)14(3)11-8-6-5-7-10-13/h12H,4-11,13H2,1-3H3 |
| InChIKey | ARNOPKWLEAYMJA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|