C6H18Cl2N2 — CID 43810640
2-N,2-N-dimethylbutane-1,2-diamine;dihydrochloride (PubChem CID 43810640) has the molecular formula C6H18Cl2N2 and a molecular weight of 189.13 g/mol. Its IUPAC name is 2-N,2-N-dimethylbutane-1,2-diamine;dihydrochloride.
| Compound Name | 2-N,2-N-dimethylbutane-1,2-diamine;dihydrochloride |
|---|---|
| PubChem CID | 43810640 |
| Molecular Formula | C6H18Cl2N2 |
| Molecular Weight | 189.13 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 2-N,2-N-dimethylbutane-1,2-diamine;dihydrochloride |
| SMILES | CCC(CN)N(C)C.Cl.Cl |
| InChI | InChI=1S/C6H16N2.2ClH/c1-4-6(5-7)8(2)3;;/h6H,4-5,7H2,1-3H3;2*1H |
| InChIKey | IMWJTZUGIAWJMX-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.13 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |