C12H28N2S2 — CID 139604826
1-[2-(dimethylamino)butyldisulfanyl]-N,N-dimethylbutan-2-amine (PubChem CID 139604826) has the molecular formula C12H28N2S2 and a molecular weight of 264.50 g/mol. Its IUPAC name is 1-[2-(dimethylamino)butyldisulfanyl]-N,N-dimethylbutan-2-amine.
| Compound Name | 1-[2-(dimethylamino)butyldisulfanyl]-N,N-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 139604826 |
| Molecular Formula | C12H28N2S2 |
| Molecular Weight | 264.50 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 1-[2-(dimethylamino)butyldisulfanyl]-N,N-dimethylbutan-2-amine |
| SMILES | CCC(CSSCC(CC)N(C)C)N(C)C |
| InChI | InChI=1S/C12H28N2S2/c1-7-11(13(3)4)9-15-16-10-12(8-2)14(5)6/h11-12H,7-10H2,1-6H3 |
| InChIKey | GXKGEEAUVRBVHH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.50 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|