C10H20ClNS — CID 103067950
N-[2-(chloromethyl)prop-2-enyl]-N-methyl-1-methylsulfanylbutan-2-amine (PubChem CID 103067950) has the molecular formula C10H20ClNS and a molecular weight of 221.80 g/mol. Its IUPAC name is N-[2-(chloromethyl)prop-2-enyl]-N-methyl-1-methylsulfanylbutan-2-amine.
| Compound Name | N-[2-(chloromethyl)prop-2-enyl]-N-methyl-1-methylsulfanylbutan-2-amine |
|---|---|
| PubChem CID | 103067950 |
| Molecular Formula | C10H20ClNS |
| Molecular Weight | 221.80 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | N-[2-(chloromethyl)prop-2-enyl]-N-methyl-1-methylsulfanylbutan-2-amine |
| SMILES | C=C(CCl)CN(C)C(CC)CSC |
| InChI | InChI=1S/C10H20ClNS/c1-5-10(8-13-4)12(3)7-9(2)6-11/h10H,2,5-8H2,1,3-4H3 |
| InChIKey | MVRCMQRFUGSLOU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.80 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|